C22H27N5O6 — CID 20641918
[4-[[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]carbamoyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 20641918) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is [4-[[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]carbamoyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [4-[[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]carbamoyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 20641918 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [4-[[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]carbamoyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | COCCOCCNC(=O)CNC(=O)c1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C22H27N5O6/c1-31-12-13-32-11-10-25-19(28)14-26-20(29)15-4-8-18(9-5-15)33-21(30)16-2-6-17(7-3-16)27-22(23)24/h2-9H,10-14H2,1H3,(H,25,28)(H,26,29)(H4,23,24,27) |
| InChIKey | RLLUFMRELDYMJN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|