C12H16N2O5 — CID 167089438
(4-nitrosophenyl) N-[2-(2-methoxyethoxy)ethyl]carbamate (PubChem CID 167089438) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (4-nitrosophenyl) N-[2-(2-methoxyethoxy)ethyl]carbamate.
| Compound Name | (4-nitrosophenyl) N-[2-(2-methoxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 167089438 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (4-nitrosophenyl) N-[2-(2-methoxyethoxy)ethyl]carbamate |
| SMILES | COCCOCCNC(=O)Oc1ccc(N=O)cc1 |
| InChI | InChI=1S/C12H16N2O5/c1-17-8-9-18-7-6-13-12(15)19-11-4-2-10(14-16)3-5-11/h2-5H,6-9H2,1H3,(H,13,15) |
| InChIKey | GSCMHSURYXWBHZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|