C17H27N5O4 — CID 20641933
4-(diaminomethylideneamino)-N-[1-[2-(2-methoxyethoxy)ethylamino]-1-oxopropan-2-yl]-N-methylbenzamide (PubChem CID 20641933) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)-N-[1-[2-(2-methoxyethoxy)ethylamino]-1-oxopropan-2-yl]-N-methylbenzamide.
| Compound Name | 4-(diaminomethylideneamino)-N-[1-[2-(2-methoxyethoxy)ethylamino]-1-oxopropan-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 20641933 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-(diaminomethylideneamino)-N-[1-[2-(2-methoxyethoxy)ethylamino]-1-oxopropan-2-yl]-N-methylbenzamide |
| SMILES | COCCOCCNC(=O)C(C)N(C)C(=O)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C17H27N5O4/c1-12(15(23)20-8-9-26-11-10-25-3)22(2)16(24)13-4-6-14(7-5-13)21-17(18)19/h4-7,12H,8-11H2,1-3H3,(H,20,23)(H4,18,19,21) |
| InChIKey | XBENYNNIGSOEMC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|