About 5-methoxy-1,2-bis(2-methoxyethoxy)pentane
5-methoxy-1,2-bis(2-methoxyethoxy)pentane (PubChem CID 20641940) has the molecular formula C12H26O5
and a molecular weight of 250.33 g/mol. Its IUPAC name is 5-methoxy-1,2-bis(2-methoxyethoxy)pentane.
Molecular Properties
| Compound Name | 5-methoxy-1,2-bis(2-methoxyethoxy)pentane |
| PubChem CID | 20641940 |
| Molecular Formula | C12H26O5 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 5-methoxy-1,2-bis(2-methoxyethoxy)pentane |
| SMILES | COCCCC(COCCOC)OCCOC |
| InChI | InChI=1S/C12H26O5/c1-13-6-4-5-12(17-10-8-15-3)11-16-9-7-14-2/h12H,4-11H2,1-3H3 |
| InChIKey | VQGLCVZMKNXUFH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,2-bis(2-methoxyethoxy)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2-bis(2-methoxyethoxy)pentane?
The IUPAC name of 5-methoxy-1,2-bis(2-methoxyethoxy)pentane (CID 20641940) is 5-methoxy-1,2-bis(2-methoxyethoxy)pentane.
What is the SMILES notation for 5-methoxy-1,2-bis(2-methoxyethoxy)pentane?
The canonical SMILES for 5-methoxy-1,2-bis(2-methoxyethoxy)pentane is COCCCC(COCCOC)OCCOC.
What is the InChIKey of 5-methoxy-1,2-bis(2-methoxyethoxy)pentane?
The InChIKey is VQGLCVZMKNXUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O5/c1-13-6-4-5-12(17-10-8-15-3)11-16-9-7-14-2/h12H,4-11H2,1-3H3.
What are the key properties of 5-methoxy-1,2-bis(2-methoxyethoxy)pentane?
5-methoxy-1,2-bis(2-methoxyethoxy)pentane has a molecular weight of 250.33 g/mol, XLogP of 1.11, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-bis(2-methoxyethoxy)pentane is sourced from PubChem (CID 20641940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).