C11H13N3O6S — CID 20643645
[3,5-dimethoxy-4-(prop-2-enoylamino)phenyl]iminosulfamic acid (PubChem CID 20643645) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is [3,5-dimethoxy-4-(prop-2-enoylamino)phenyl]iminosulfamic acid.
| Compound Name | [3,5-dimethoxy-4-(prop-2-enoylamino)phenyl]iminosulfamic acid |
|---|---|
| PubChem CID | 20643645 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | [3,5-dimethoxy-4-(prop-2-enoylamino)phenyl]iminosulfamic acid |
| SMILES | C=CC(=O)Nc1c(OC)cc(/N=N/S(=O)(=O)O)cc1OC |
| InChI | InChI=1S/C11H13N3O6S/c1-4-10(15)12-11-8(19-2)5-7(6-9(11)20-3)13-14-21(16,17)18/h4-6H,1H2,2-3H3,(H,12,15)(H,16,17,18)/b14-13+ |
| InChIKey | KRUDFMVQOJXRCX-BUHFOSPRSA-N |
| XLogP | 1.71 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|