C20H16Cl2N2O5 — CID 20645310
2,5-dichloro-3-(3-hydroxy-4-methoxyanilino)-6-(3-hydroxy-4-methylanilino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 20645310) has the molecular formula C20H16Cl2N2O5 and a molecular weight of 435.26 g/mol. Its IUPAC name is 2,5-dichloro-3-(3-hydroxy-4-methoxyanilino)-6-(3-hydroxy-4-methylanilino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-(3-hydroxy-4-methoxyanilino)-6-(3-hydroxy-4-methylanilino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 20645310 |
| Molecular Formula | C20H16Cl2N2O5 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2,5-dichloro-3-(3-hydroxy-4-methoxyanilino)-6-(3-hydroxy-4-methylanilino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)C(Nc3ccc(C)c(O)c3)=C(Cl)C2=O)cc1O |
| InChI | InChI=1S/C20H16Cl2N2O5/c1-9-3-4-10(7-12(9)25)23-17-15(21)20(28)18(16(22)19(17)27)24-11-5-6-14(29-2)13(26)8-11/h3-8,23-26H,1-2H3 |
| InChIKey | KBYGIKQFVSVZRF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|