C24H23N3O5S — CID 20646413
ethyl 2-[3-[(E)-3-[4-(ethylsulfonylamino)phenyl]-2-isocyano-3-oxoprop-1-enyl]indol-1-yl]acetate (PubChem CID 20646413) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-3-[4-(ethylsulfonylamino)phenyl]-2-isocyano-3-oxoprop-1-enyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(E)-3-[4-(ethylsulfonylamino)phenyl]-2-isocyano-3-oxoprop-1-enyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 20646413 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | ethyl 2-[3-[(E)-3-[4-(ethylsulfonylamino)phenyl]-2-isocyano-3-oxoprop-1-enyl]indol-1-yl]acetate |
| SMILES | [C-]#[N+]/C(=C/c1cn(CC(=O)OCC)c2ccccc12)C(=O)c1ccc(NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C24H23N3O5S/c1-4-32-23(28)16-27-15-18(20-8-6-7-9-22(20)27)14-21(25-3)24(29)17-10-12-19(13-11-17)26-33(30,31)5-2/h6-15,26H,4-5,16H2,1-2H3/b21-14+ |
| InChIKey | UELWFPVRPBOFIS-KGENOOAVSA-N |
| XLogP | 4.11 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|