C19H28ClN3O6 — CID 20652151
[7-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-(2-chloroethyl)carbamate (PubChem CID 20652151) has the molecular formula C19H28ClN3O6 and a molecular weight of 429.90 g/mol. Its IUPAC name is [7-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-(2-chloroethyl)carbamate.
| Compound Name | [7-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 20652151 |
| Molecular Formula | C19H28ClN3O6 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [7-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-(2-chloroethyl)carbamate |
| SMILES | CC12OC1CC1C(C(=O)N3CCN(CCO)CC3)=COC(OC(=O)NCCCl)C12 |
| InChI | InChI=1S/C19H28ClN3O6/c1-19-14(29-19)10-12-13(16(25)23-6-4-22(5-7-23)8-9-24)11-27-17(15(12)19)28-18(26)21-3-2-20/h11-12,14-15,17,24H,2-10H2,1H3,(H,21,26) |
| InChIKey | HRIOHBLMUGOJBK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|