C23H42O6 — CID 20652915
6-methoxycarbonyl-2,2,4,6-tetramethyl-4-octoxycarbonyloctanoic acid (PubChem CID 20652915) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is 6-methoxycarbonyl-2,2,4,6-tetramethyl-4-octoxycarbonyloctanoic acid.
| Compound Name | 6-methoxycarbonyl-2,2,4,6-tetramethyl-4-octoxycarbonyloctanoic acid |
|---|---|
| PubChem CID | 20652915 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 6-methoxycarbonyl-2,2,4,6-tetramethyl-4-octoxycarbonyloctanoic acid |
| SMILES | CCCCCCCCOC(=O)C(C)(CC(C)(C)C(=O)O)CC(C)(CC)C(=O)OC |
| InChI | InChI=1S/C23H42O6/c1-8-10-11-12-13-14-15-29-20(27)23(6,16-21(3,4)18(24)25)17-22(5,9-2)19(26)28-7/h8-17H2,1-7H3,(H,24,25) |
| InChIKey | BLFHPOKISIWLFC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|