C27H20ClN3O5 — CID 20653586
methyl 2-[(2-chloro-6-methylbenzoyl)amino]-3-[4-(5-isocyano-1,3-dioxoisoindol-2-yl)phenyl]propanoate (PubChem CID 20653586) has the molecular formula C27H20ClN3O5 and a molecular weight of 501.93 g/mol. Its IUPAC name is methyl 2-[(2-chloro-6-methylbenzoyl)amino]-3-[4-(5-isocyano-1,3-dioxoisoindol-2-yl)phenyl]propanoate.
| Compound Name | methyl 2-[(2-chloro-6-methylbenzoyl)amino]-3-[4-(5-isocyano-1,3-dioxoisoindol-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 20653586 |
| Molecular Formula | C27H20ClN3O5 |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | methyl 2-[(2-chloro-6-methylbenzoyl)amino]-3-[4-(5-isocyano-1,3-dioxoisoindol-2-yl)phenyl]propanoate |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(=O)N(c1ccc(CC(NC(=O)c3c(C)cccc3Cl)C(=O)OC)cc1)C2=O |
| InChI | InChI=1S/C27H20ClN3O5/c1-15-5-4-6-21(28)23(15)24(32)30-22(27(35)36-3)13-16-7-10-18(11-8-16)31-25(33)19-12-9-17(29-2)14-20(19)26(31)34/h4-12,14,22H,13H2,1,3H3,(H,30,32) |
| InChIKey | XRCABWNUWWLDGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|