C28H25Cl2N3O5 — CID 58567436
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[7-(dimethylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]propanoate (PubChem CID 58567436) has the molecular formula C28H25Cl2N3O5 and a molecular weight of 554.43 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[7-(dimethylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[7-(dimethylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 58567436 |
| Molecular Formula | C28H25Cl2N3O5 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[7-(dimethylamino)-1,3-dioxo-4H-isoquinolin-2-yl]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N2C(=O)Cc3ccc(N(C)C)cc3C2=O)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C28H25Cl2N3O5/c1-32(2)19-12-9-17-14-24(34)33(27(36)20(17)15-19)18-10-7-16(8-11-18)13-23(28(37)38-3)31-26(35)25-21(29)5-4-6-22(25)30/h4-12,15,23H,13-14H2,1-3H3,(H,31,35)/t23-/m0/s1 |
| InChIKey | FYGOHCPDDITOEN-QHCPKHFHSA-N |
| XLogP | 4.30 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|