C39H61FO — CID 20654376
4-[(E)-2-[4-[4-[(E)-dec-1-enyl]cyclohexyl]cyclohexyl]ethenyl]-1-[4-(ethoxymethyl)cyclohexyl]-2-fluorobenzene (PubChem CID 20654376) has the molecular formula C39H61FO and a molecular weight of 564.91 g/mol. Its IUPAC name is 4-[(E)-2-[4-[4-[(E)-dec-1-enyl]cyclohexyl]cyclohexyl]ethenyl]-1-[4-(ethoxymethyl)cyclohexyl]-2-fluorobenzene.
| Compound Name | 4-[(E)-2-[4-[4-[(E)-dec-1-enyl]cyclohexyl]cyclohexyl]ethenyl]-1-[4-(ethoxymethyl)cyclohexyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 20654376 |
| Molecular Formula | C39H61FO |
| Molecular Weight | 564.91 g/mol |
| Exact Mass | 564.47 |
| IUPAC Name | 4-[(E)-2-[4-[4-[(E)-dec-1-enyl]cyclohexyl]cyclohexyl]ethenyl]-1-[4-(ethoxymethyl)cyclohexyl]-2-fluorobenzene |
| SMILES | CCCCCCCC/C=C/C1CCC(C2CCC(/C=C/c3ccc(C4CCC(COCC)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C39H61FO/c1-3-5-6-7-8-9-10-11-12-31-15-22-35(23-16-31)36-24-17-32(18-25-36)13-14-33-21-28-38(39(40)29-33)37-26-19-34(20-27-37)30-41-4-2/h11-14,21,28-29,31-32,34-37H,3-10,15-20,22-27,30H2,1-2H3/b12-11+,14-13+ |
| InChIKey | WUCOTXUHQAONOF-LDHFCIDVSA-N |
| XLogP | 12.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.91 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|