C25H24N4O2S — CID 20655226
2-[4-(hydroperoxymethyl)phenyl]-5-[6-(4-phenylpiperidin-1-yl)-3-pyridinyl]-1,3,4-thiadiazole (PubChem CID 20655226) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[4-(hydroperoxymethyl)phenyl]-5-[6-(4-phenylpiperidin-1-yl)-3-pyridinyl]-1,3,4-thiadiazole.
| Compound Name | 2-[4-(hydroperoxymethyl)phenyl]-5-[6-(4-phenylpiperidin-1-yl)-3-pyridinyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 20655226 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[4-(hydroperoxymethyl)phenyl]-5-[6-(4-phenylpiperidin-1-yl)-3-pyridinyl]-1,3,4-thiadiazole |
| SMILES | OOCc1ccc(-c2nnc(-c3ccc(N4CCC(c5ccccc5)CC4)nc3)s2)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c30-31-17-18-6-8-21(9-7-18)24-27-28-25(32-24)22-10-11-23(26-16-22)29-14-12-20(13-15-29)19-4-2-1-3-5-19/h1-11,16,20,30H,12-15,17H2 |
| InChIKey | IFMSRUASOPITOX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|