C6H11NO4 — CID 20659480
N,4-dihydroxy-N-methyl-3-oxopentanamide (PubChem CID 20659480) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is N,4-dihydroxy-N-methyl-3-oxopentanamide.
| Compound Name | N,4-dihydroxy-N-methyl-3-oxopentanamide |
|---|---|
| PubChem CID | 20659480 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | N,4-dihydroxy-N-methyl-3-oxopentanamide |
| SMILES | CC(O)C(=O)CC(=O)N(C)O |
| InChI | InChI=1S/C6H11NO4/c1-4(8)5(9)3-6(10)7(2)11/h4,8,11H,3H2,1-2H3 |
| InChIKey | RVCGVIJFISVELS-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|