C21H22N2O7 — CID 20659602
3-[[4-hydroxy-1-(2-naphthalen-1-yloxyacetyl)pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 20659602) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is 3-[[4-hydroxy-1-(2-naphthalen-1-yloxyacetyl)pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[4-hydroxy-1-(2-naphthalen-1-yloxyacetyl)pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20659602 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[[4-hydroxy-1-(2-naphthalen-1-yloxyacetyl)pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CC(O)CN1C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O7/c24-11-14(8-20(27)28)22-21(29)17-9-15(25)10-23(17)19(26)12-30-18-7-3-5-13-4-1-2-6-16(13)18/h1-7,11,14-15,17,25H,8-10,12H2,(H,22,29)(H,27,28) |
| InChIKey | DAXOAAPALXRKNX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|