C23H14F6N2 — CID 20660787
3-phenyl-N,N'-bis[2-(trifluoromethyl)phenyl]prop-2-ynimidamide (PubChem CID 20660787) has the molecular formula C23H14F6N2 and a molecular weight of 432.37 g/mol. Its IUPAC name is 3-phenyl-N,N'-bis[2-(trifluoromethyl)phenyl]prop-2-ynimidamide.
| Compound Name | 3-phenyl-N,N'-bis[2-(trifluoromethyl)phenyl]prop-2-ynimidamide |
|---|---|
| PubChem CID | 20660787 |
| Molecular Formula | C23H14F6N2 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 3-phenyl-N,N'-bis[2-(trifluoromethyl)phenyl]prop-2-ynimidamide |
| SMILES | FC(F)(F)c1ccccc1/N=C(\C#Cc1ccccc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H14F6N2/c24-22(25,26)17-10-4-6-12-19(17)30-21(15-14-16-8-2-1-3-9-16)31-20-13-7-5-11-18(20)23(27,28)29/h1-13H,(H,30,31) |
| InChIKey | RTAMWIKQRQMHOK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|