About [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate
[4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate (PubChem CID 20663280) has the molecular formula C24H19FO2
and a molecular weight of 358.41 g/mol. Its IUPAC name is [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate |
| PubChem CID | 20663280 |
| Molecular Formula | C24H19FO2 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate |
| SMILES | C#CCCc1ccc(-c2ccc(OC(=O)c3ccc(C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H19FO2/c1-3-4-5-18-8-12-19(13-9-18)21-14-15-23(22(25)16-21)27-24(26)20-10-6-17(2)7-11-20/h1,6-16H,4-5H2,2H3 |
| InChIKey | YYQUWSUGWDPBCW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate?
The IUPAC name of [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate (CID 20663280) is [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate.
What is the SMILES notation for [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate?
The canonical SMILES for [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate is C#CCCc1ccc(-c2ccc(OC(=O)c3ccc(C)cc3)c(F)c2)cc1.
What is the InChIKey of [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate?
The InChIKey is YYQUWSUGWDPBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19FO2/c1-3-4-5-18-8-12-19(13-9-18)21-14-15-23(22(25)16-21)27-24(26)20-10-6-17(2)7-11-20/h1,6-16H,4-5H2,2H3.
What are the key properties of [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate?
[4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate has a molecular weight of 358.41 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-but-3-ynylphenyl)-2-fluorophenyl] 4-methylbenzoate is sourced from PubChem (CID 20663280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).