C72H57F3O6 — CID 90964209
bis((4-but-3-ynyl-2-fluorophenyl) 4-(4-methylphenyl)benzoate);[4-(4-methylphenyl)phenyl] 4-but-3-ynyl-2-fluorobenzoate (PubChem CID 90964209) has the molecular formula C72H57F3O6 and a molecular weight of 1075.24 g/mol. Its IUPAC name is bis((4-but-3-ynyl-2-fluorophenyl) 4-(4-methylphenyl)benzoate);[4-(4-methylphenyl)phenyl] 4-but-3-ynyl-2-fluorobenzoate.
| Compound Name | bis((4-but-3-ynyl-2-fluorophenyl) 4-(4-methylphenyl)benzoate);[4-(4-methylphenyl)phenyl] 4-but-3-ynyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 90964209 |
| Molecular Formula | C72H57F3O6 |
| Molecular Weight | 1075.24 g/mol |
| Exact Mass | 1074.41 |
| IUPAC Name | bis((4-but-3-ynyl-2-fluorophenyl) 4-(4-methylphenyl)benzoate);[4-(4-methylphenyl)phenyl] 4-but-3-ynyl-2-fluorobenzoate |
| SMILES | C#CCCc1ccc(C(=O)Oc2ccc(-c3ccc(C)cc3)cc2)c(F)c1.C#CCCc1ccc(OC(=O)c2ccc(-c3ccc(C)cc3)cc2)c(F)c1.C#CCCc1ccc(OC(=O)c2ccc(-c3ccc(C)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/3C24H19FO2/c2*1-3-4-5-18-8-15-23(22(25)16-18)27-24(26)21-13-11-20(12-14-21)19-9-6-17(2)7-10-19;1-3-4-5-18-8-15-22(23(25)16-18)24(26)27-21-13-11-20(12-14-21)19-9-6-17(2)7-10-19/h3*1,6-16H,4-5H2,2H3 |
| InChIKey | RUHFXNVDVLUZAL-UHFFFAOYSA-N |
| XLogP | 16.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.24 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|