C20H32O4 — CID 20668788
methyl 2-(1,4,6,7,8,8a-hexamethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate (PubChem CID 20668788) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is methyl 2-(1,4,6,7,8,8a-hexamethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate.
| Compound Name | methyl 2-(1,4,6,7,8,8a-hexamethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 20668788 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | methyl 2-(1,4,6,7,8,8a-hexamethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl)-2-hydroxypropanoate |
| SMILES | COC(=O)C(C)(O)C1C(=O)C(C)=C2CC(C)C(C)C(C)C2(C)C1C |
| InChI | InChI=1S/C20H32O4/c1-10-9-15-12(3)17(21)16(20(7,23)18(22)24-8)14(5)19(15,6)13(4)11(10)2/h10-11,13-14,16,23H,9H2,1-8H3 |
| InChIKey | LKWBTWHWXLJCNR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |