C15H20O7 — CID 22982305
methyl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(3-methyl-5-oxooxolan-2-yl)propanoate (PubChem CID 22982305) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(3-methyl-5-oxooxolan-2-yl)propanoate.
| Compound Name | methyl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(3-methyl-5-oxooxolan-2-yl)propanoate |
|---|---|
| PubChem CID | 22982305 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 2-methyl-2-(4-methyl-2,5-dioxooxolan-3-yl)-3-(3-methyl-5-oxooxolan-2-yl)propanoate |
| SMILES | COC(=O)C(C)(CC1OC(=O)CC1C)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C15H20O7/c1-7-5-10(16)21-9(7)6-15(3,14(19)20-4)11-8(2)12(17)22-13(11)18/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | JGIUYOAAQOLWGT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|