C30H36N2O6 — CID 20670276
(4-methoxy-2,6-dimethylphenyl) 4-(1,3-dioxoisoindol-2-yl)-5-(2-ethylpiperidin-1-yl)-3-methyl-5-oxopentanoate (PubChem CID 20670276) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is (4-methoxy-2,6-dimethylphenyl) 4-(1,3-dioxoisoindol-2-yl)-5-(2-ethylpiperidin-1-yl)-3-methyl-5-oxopentanoate.
| Compound Name | (4-methoxy-2,6-dimethylphenyl) 4-(1,3-dioxoisoindol-2-yl)-5-(2-ethylpiperidin-1-yl)-3-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 20670276 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (4-methoxy-2,6-dimethylphenyl) 4-(1,3-dioxoisoindol-2-yl)-5-(2-ethylpiperidin-1-yl)-3-methyl-5-oxopentanoate |
| SMILES | CCC1CCCCN1C(=O)C(C(C)CC(=O)Oc1c(C)cc(OC)cc1C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H36N2O6/c1-6-21-11-9-10-14-31(21)30(36)26(32-28(34)23-12-7-8-13-24(23)29(32)35)18(2)17-25(33)38-27-19(3)15-22(37-5)16-20(27)4/h7-8,12-13,15-16,18,21,26H,6,9-11,14,17H2,1-5H3 |
| InChIKey | GDBNGWIKNYMGPL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|