C12H24N2O4S — CID 20670971
N-[2,2,6,6-tetramethyl-1-(trioxidanylsulfanylmethyl)piperidin-4-yl]acetamide (PubChem CID 20670971) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[2,2,6,6-tetramethyl-1-(trioxidanylsulfanylmethyl)piperidin-4-yl]acetamide.
| Compound Name | N-[2,2,6,6-tetramethyl-1-(trioxidanylsulfanylmethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 20670971 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[2,2,6,6-tetramethyl-1-(trioxidanylsulfanylmethyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CC(C)(C)N(CSOOO)C(C)(C)C1 |
| InChI | InChI=1S/C12H24N2O4S/c1-9(15)13-10-6-11(2,3)14(8-19-18-17-16)12(4,5)7-10/h10,16H,6-8H2,1-5H3,(H,13,15) |
| InChIKey | UGTYGNYTKQAUEQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|