About (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate
(2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate (PubChem CID 20671212) has the molecular formula C18H28O3
and a molecular weight of 292.42 g/mol. Its IUPAC name is (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate.
Analyze (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate?
The IUPAC name of (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate (CID 20671212) is (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate.
What is the SMILES notation for (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate?
The canonical SMILES for (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate is COC1CCCCC1OC(=O)C1CC2C3CCC(C3)C2C1.
What is the InChIKey of (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate?
The InChIKey is PRBDIIDRIOOAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3/c1-20-16-4-2-3-5-17(16)21-18(19)13-9-14-11-6-7-12(8-11)15(14)10-13/h11-17H,2-10H2,1H3.
What are the key properties of (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate?
(2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate has a molecular weight of 292.42 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxycyclohexyl) tricyclo[5.2.1.02,6]decane-4-carboxylate is sourced from PubChem (CID 20671212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).