C17H33FO4PSi+ — CID 20672764
[4-fluoro-1-(2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl)octan-3-yl]oxy-dimethylsilanylium (PubChem CID 20672764) has the molecular formula C17H33FO4PSi+ and a molecular weight of 379.51 g/mol. Its IUPAC name is [4-fluoro-1-(2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl)octan-3-yl]oxy-dimethylsilanylium.
| Compound Name | [4-fluoro-1-(2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl)octan-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 20672764 |
| Molecular Formula | C17H33FO4PSi+ |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [4-fluoro-1-(2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl)octan-3-yl]oxy-dimethylsilanylium |
| SMILES | CCCCC(F)C(CCC1C(OP)CC2OC(=O)CC21)O[SiH2+](C)C |
| InChI | InChI=1S/C17H33FO4PSi/c1-4-5-6-13(18)14(22-24(2)3)8-7-11-12-9-17(19)20-15(12)10-16(11)21-23/h11-16H,4-10,23-24H2,1-3H3/q+1 |
| InChIKey | RJLIVYLGIVKBOP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|