C12H25N3O+2 — CID 20676100
2-(4-tert-butyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (PubChem CID 20676100) has the molecular formula C12H25N3O+2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
| Compound Name | 2-(4-tert-butyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
|---|---|
| PubChem CID | 20676100 |
| Molecular Formula | C12H25N3O+2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 2-(4-tert-butyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| SMILES | CC(C)(C)[N+]12CC[N+](CC(N)=O)(CC1)CC2 |
| InChI | InChI=1S/C12H24N3O/c1-12(2,3)15-7-4-14(5-8-15,6-9-15)10-11(13)16/h4-10H2,1-3H3,(H-,13,16)/q+1/p+1 |
| InChIKey | KINOLLRYBVMKOP-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|