C12H12N4O — CID 20676360
N-(diaminomethylidene)-4-azatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraene-3-carboxamide (PubChem CID 20676360) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-azatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraene-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-azatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 20676360 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-(diaminomethylidene)-4-azatricyclo[5.3.1.04,11]undeca-1(11),2,7,9-tetraene-3-carboxamide |
| SMILES | NC(N)=NC(=O)c1cc2cccc3c2n1CC3 |
| InChI | InChI=1S/C12H12N4O/c13-12(14)15-11(17)9-6-8-3-1-2-7-4-5-16(9)10(7)8/h1-3,6H,4-5H2,(H4,13,14,15,17) |
| InChIKey | QMTVQAQQHFOKQO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|