C16H19N5O2 — CID 20676380
N-(diaminomethylidene)-5,11-dimethyl-9-oxo-1,11-diazatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide (PubChem CID 20676380) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-5,11-dimethyl-9-oxo-1,11-diazatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-5,11-dimethyl-9-oxo-1,11-diazatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 20676380 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-(diaminomethylidene)-5,11-dimethyl-9-oxo-1,11-diazatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide |
| SMILES | Cc1ccc2c3c1cc(C(=O)N=C(N)N)n3CCN(C)CC2=O |
| InChI | InChI=1S/C16H19N5O2/c1-9-3-4-10-13(22)8-20(2)5-6-21-12(7-11(9)14(10)21)15(23)19-16(17)18/h3-4,7H,5-6,8H2,1-2H3,(H4,17,18,19,23) |
| InChIKey | UYJDXBYQQMSAGT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|