C14H14F3N5O — CID 15432801
N-(diaminomethylidene)-9-methyl-5-(trifluoromethyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-2-carboxamide (PubChem CID 15432801) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is N-(diaminomethylidene)-9-methyl-5-(trifluoromethyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-9-methyl-5-(trifluoromethyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 15432801 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(diaminomethylidene)-9-methyl-5-(trifluoromethyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene-2-carboxamide |
| SMILES | CN1CCn2c(C(=O)N=C(N)N)cc3c(C(F)(F)F)ccc1c32 |
| InChI | InChI=1S/C14H14F3N5O/c1-21-4-5-22-10(12(23)20-13(18)19)6-7-8(14(15,16)17)2-3-9(21)11(7)22/h2-3,6H,4-5H2,1H3,(H4,18,19,20,23) |
| InChIKey | OVTAVDVKIGWVMV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|