C16H17ClN4O3 — CID 20676385
5-chloro-N-(diaminomethylidene)-7-methoxy-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide (PubChem CID 20676385) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 5-chloro-N-(diaminomethylidene)-7-methoxy-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide.
| Compound Name | 5-chloro-N-(diaminomethylidene)-7-methoxy-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 20676385 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-chloro-N-(diaminomethylidene)-7-methoxy-9-oxo-1-azatricyclo[6.5.1.04,14]tetradeca-2,4,6,8(14)-tetraene-2-carboxamide |
| SMILES | COc1cc(Cl)c2cc(C(=O)N=C(N)N)n3c2c1C(=O)CCCC3 |
| InChI | InChI=1S/C16H17ClN4O3/c1-24-12-7-9(17)8-6-10(15(23)20-16(18)19)21-5-3-2-4-11(22)13(12)14(8)21/h6-7H,2-5H2,1H3,(H4,18,19,20,23) |
| InChIKey | GLOYLOXJOBTXEV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|