C17H23ClO3 — CID 68813134
1-(4-chloro-2,5-dimethoxyphenyl)-1-cyclohexylpropan-2-one (PubChem CID 68813134) has the molecular formula C17H23ClO3 and a molecular weight of 310.82 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-1-cyclohexylpropan-2-one.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-1-cyclohexylpropan-2-one |
|---|---|
| PubChem CID | 68813134 |
| Molecular Formula | C17H23ClO3 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-1-cyclohexylpropan-2-one |
| SMILES | COc1cc(C(C(C)=O)C2CCCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H23ClO3/c1-11(19)17(12-7-5-4-6-8-12)13-9-16(21-3)14(18)10-15(13)20-2/h9-10,12,17H,4-8H2,1-3H3 |
| InChIKey | QYGAJNGEWYFTLK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |