C9H15N5O3 — CID 20678386
N,4-dimethyl-N-(oxan-4-yl)-5-oxotetrazole-1-carboxamide (PubChem CID 20678386) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is N,4-dimethyl-N-(oxan-4-yl)-5-oxotetrazole-1-carboxamide.
| Compound Name | N,4-dimethyl-N-(oxan-4-yl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 20678386 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N,4-dimethyl-N-(oxan-4-yl)-5-oxotetrazole-1-carboxamide |
| SMILES | CN(C(=O)n1nnn(C)c1=O)C1CCOCC1 |
| InChI | InChI=1S/C9H15N5O3/c1-12(7-3-5-17-6-4-7)8(15)14-9(16)13(2)10-11-14/h7H,3-6H2,1-2H3 |
| InChIKey | XEKMXCQLGUOESH-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|