C14H31N4O4+ — CID 20680267
[3-[aminomethyl-[(6-oxohexanoylamino)methyl]amino]-2-hydroxypropyl]-(hydroxymethyl)-dimethylazanium (PubChem CID 20680267) has the molecular formula C14H31N4O4+ and a molecular weight of 319.43 g/mol. Its IUPAC name is [3-[aminomethyl-[(6-oxohexanoylamino)methyl]amino]-2-hydroxypropyl]-(hydroxymethyl)-dimethylazanium.
| Compound Name | [3-[aminomethyl-[(6-oxohexanoylamino)methyl]amino]-2-hydroxypropyl]-(hydroxymethyl)-dimethylazanium |
|---|---|
| PubChem CID | 20680267 |
| Molecular Formula | C14H31N4O4+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | [3-[aminomethyl-[(6-oxohexanoylamino)methyl]amino]-2-hydroxypropyl]-(hydroxymethyl)-dimethylazanium |
| SMILES | C[N+](C)(CO)CC(O)CN(CN)CNC(=O)CCCCC=O |
| InChI | InChI=1S/C14H30N4O4/c1-18(2,12-20)9-13(21)8-17(10-15)11-16-14(22)6-4-3-5-7-19/h7,13,20-21H,3-6,8-12,15H2,1-2H3/p+1 |
| InChIKey | BTCMMHLXYRGHIF-UHFFFAOYSA-O |
| XLogP | -1.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|