About 8-hydroxy-6-oxononanal
8-hydroxy-6-oxononanal (PubChem CID 91579516) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 8-hydroxy-6-oxononanal.
Molecular Properties
| Compound Name | 8-hydroxy-6-oxononanal |
| PubChem CID | 91579516 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 8-hydroxy-6-oxononanal |
| SMILES | CC(O)CC(=O)CCCCC=O |
| InChI | InChI=1S/C9H16O3/c1-8(11)7-9(12)5-3-2-4-6-10/h6,8,11H,2-5,7H2,1H3 |
| InChIKey | RCJLTELYNJRNPC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxy-6-oxononanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-6-oxononanal?
The IUPAC name of 8-hydroxy-6-oxononanal (CID 91579516) is 8-hydroxy-6-oxononanal.
What is the SMILES notation for 8-hydroxy-6-oxononanal?
The canonical SMILES for 8-hydroxy-6-oxononanal is CC(O)CC(=O)CCCCC=O.
What is the InChIKey of 8-hydroxy-6-oxononanal?
The InChIKey is RCJLTELYNJRNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-8(11)7-9(12)5-3-2-4-6-10/h6,8,11H,2-5,7H2,1H3.
What are the key properties of 8-hydroxy-6-oxononanal?
8-hydroxy-6-oxononanal has a molecular weight of 172.22 g/mol, XLogP of 1.09, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-6-oxononanal is sourced from PubChem (CID 91579516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).