C17H16ClN3O — CID 20681433
2-chloro-N,N-dimethyl-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetamide (PubChem CID 20681433) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetamide.
| Compound Name | 2-chloro-N,N-dimethyl-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 20681433 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-chloro-N,N-dimethyl-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetamide |
| SMILES | CN(C)C(=O)C(Cl)c1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C17H16ClN3O/c1-20(2)17(22)14(18)16-15(12-8-4-3-5-9-12)19-13-10-6-7-11-21(13)16/h3-11,14H,1-2H3 |
| InChIKey | DRUTZMIWWQSHRA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|