C31H44N4Si2 — CID 20682158
N,N'-bis[dimethyl-(3-pyrrolidin-1-yl-3H-inden-1-yl)silyl]methanediamine (PubChem CID 20682158) has the molecular formula C31H44N4Si2 and a molecular weight of 528.89 g/mol. Its IUPAC name is N,N'-bis[dimethyl-(3-pyrrolidin-1-yl-3H-inden-1-yl)silyl]methanediamine.
| Compound Name | N,N'-bis[dimethyl-(3-pyrrolidin-1-yl-3H-inden-1-yl)silyl]methanediamine |
|---|---|
| PubChem CID | 20682158 |
| Molecular Formula | C31H44N4Si2 |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | N,N'-bis[dimethyl-(3-pyrrolidin-1-yl-3H-inden-1-yl)silyl]methanediamine |
| SMILES | C[Si](C)(NCN[Si](C)(C)C1=CC(N2CCCC2)c2ccccc21)C1=CC(N2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C31H44N4Si2/c1-36(2,30-21-28(34-17-9-10-18-34)24-13-5-7-15-26(24)30)32-23-33-37(3,4)31-22-29(35-19-11-12-20-35)25-14-6-8-16-27(25)31/h5-8,13-16,21-22,28-29,32-33H,9-12,17-20,23H2,1-4H3 |
| InChIKey | IBOYXAHJTYZZPA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|