C10H13NO3S3 — CID 20686120
4-morpholin-4-ylperoxysulfanylbenzene-1,2-dithiol (PubChem CID 20686120) has the molecular formula C10H13NO3S3 and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-morpholin-4-ylperoxysulfanylbenzene-1,2-dithiol.
| Compound Name | 4-morpholin-4-ylperoxysulfanylbenzene-1,2-dithiol |
|---|---|
| PubChem CID | 20686120 |
| Molecular Formula | C10H13NO3S3 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-morpholin-4-ylperoxysulfanylbenzene-1,2-dithiol |
| SMILES | Sc1ccc(SOON2CCOCC2)cc1S |
| InChI | InChI=1S/C10H13NO3S3/c15-9-2-1-8(7-10(9)16)17-14-13-11-3-5-12-6-4-11/h1-2,7,15-16H,3-6H2 |
| InChIKey | JUFUDUUMPHWJGV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|