About tricyclo[5.3.0.02,5]decane
tricyclo[5.3.0.02,5]decane (PubChem CID 20688147) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is tricyclo[5.3.0.02,5]decane.
Molecular Properties
| Compound Name | tricyclo[5.3.0.02,5]decane |
| PubChem CID | 20688147 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | tricyclo[5.3.0.02,5]decane |
| SMILES | C1CC2CC3CCC3C2C1 |
| InChI | InChI=1S/C10H16/c1-2-7-6-8-4-5-10(8)9(7)3-1/h7-10H,1-6H2 |
| InChIKey | PDZHXRXHUDFRNE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[5.3.0.02,5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.3.0.02,5]decane?
The IUPAC name of tricyclo[5.3.0.02,5]decane (CID 20688147) is tricyclo[5.3.0.02,5]decane.
What is the SMILES notation for tricyclo[5.3.0.02,5]decane?
The canonical SMILES for tricyclo[5.3.0.02,5]decane is C1CC2CC3CCC3C2C1.
What is the InChIKey of tricyclo[5.3.0.02,5]decane?
The InChIKey is PDZHXRXHUDFRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-2-7-6-8-4-5-10(8)9(7)3-1/h7-10H,1-6H2.
What are the key properties of tricyclo[5.3.0.02,5]decane?
tricyclo[5.3.0.02,5]decane has a molecular weight of 136.24 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.3.0.02,5]decane is sourced from PubChem (CID 20688147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).