About sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate
sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate (PubChem CID 20688572) has the molecular formula C9H6ClN2NaO9S
and a molecular weight of 376.66 g/mol. Its IUPAC name is sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate.
Molecular Properties
| Compound Name | sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate |
| PubChem CID | 20688572 |
| Molecular Formula | C9H6ClN2NaO9S |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate |
| SMILES | O=C(Oc1ccc(SOO[O-])c([N+](=O)[O-])c1)C(CCl)[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C9H7ClN2O9S.Na/c10-4-7(12(16)17)9(13)19-5-1-2-8(22-21-20-18)6(3-5)11(14)15;/h1-3,7,18H,4H2;/q;+1/p-1 |
| InChIKey | VCPRNZKJMKKYJO-UHFFFAOYSA-M |
| XLogP | -2.38 |
| TPSA | 154.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate?
The IUPAC name of sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate (CID 20688572) is sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate.
What is the SMILES notation for sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate?
The canonical SMILES for sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate is O=C(Oc1ccc(SOO[O-])c([N+](=O)[O-])c1)C(CCl)[N+](=O)[O-].[Na+].
What is the InChIKey of sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate?
The InChIKey is VCPRNZKJMKKYJO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7ClN2O9S.Na/c10-4-7(12(16)17)9(13)19-5-1-2-8(22-21-20-18)6(3-5)11(14)15;/h1-3,7,18H,4H2;/q;+1/p-1.
What are the key properties of sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate?
sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate has a molecular weight of 376.66 g/mol, XLogP of -2.38, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (3-nitro-4-oxidoperoxysulfanylphenyl) 3-chloro-2-nitropropanoate is sourced from PubChem (CID 20688572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).