C14H13N3OS2 — CID 20690533
1-(2-methyl-1-benzofuran-5-yl)-3-(5-methyl-1,3-thiazol-2-yl)thiourea (PubChem CID 20690533) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(2-methyl-1-benzofuran-5-yl)-3-(5-methyl-1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-(2-methyl-1-benzofuran-5-yl)-3-(5-methyl-1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 20690533 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-(2-methyl-1-benzofuran-5-yl)-3-(5-methyl-1,3-thiazol-2-yl)thiourea |
| SMILES | Cc1cc2cc(NC(=S)Nc3ncc(C)s3)ccc2o1 |
| InChI | InChI=1S/C14H13N3OS2/c1-8-5-10-6-11(3-4-12(10)18-8)16-13(19)17-14-15-7-9(2)20-14/h3-7H,1-2H3,(H2,15,16,17,19) |
| InChIKey | ZYJONMSFXZUITN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|