C4H6N2OS — CID 143425859
N-(5-methyl-1,3-thiazol-2-yl)hydroxylamine (PubChem CID 143425859) has the molecular formula C4H6N2OS and a molecular weight of 130.17 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)hydroxylamine.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 143425859 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)hydroxylamine |
| SMILES | Cc1cnc(NO)s1 |
| InChI | InChI=1S/C4H6N2OS/c1-3-2-5-4(6-7)8-3/h2,7H,1H3,(H,5,6) |
| InChIKey | RNXYBKWLIMUFEY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|