C23H32N6O2S — CID 20690755
1-cyano-2-[2-(3-methylsulfanylphenyl)ethyl]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine (PubChem CID 20690755) has the molecular formula C23H32N6O2S and a molecular weight of 456.62 g/mol. Its IUPAC name is 1-cyano-2-[2-(3-methylsulfanylphenyl)ethyl]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine.
| Compound Name | 1-cyano-2-[2-(3-methylsulfanylphenyl)ethyl]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
|---|---|
| PubChem CID | 20690755 |
| Molecular Formula | C23H32N6O2S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 1-cyano-2-[2-(3-methylsulfanylphenyl)ethyl]-3-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
| SMILES | CSc1cccc(CC/N=C(\NC#N)NC2CCCCN(CC(=O)N3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C23H32N6O2S/c1-32-19-8-6-7-18(15-19)10-11-25-23(26-17-24)27-20-9-2-3-14-29(22(20)31)16-21(30)28-12-4-5-13-28/h6-8,15,20H,2-5,9-14,16H2,1H3,(H2,25,26,27) |
| InChIKey | FKAGWJUMHUXTQE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|