C24H34N6O3 — CID 59969785
1-cyano-2-[2-(2-ethoxyphenyl)ethyl]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine (PubChem CID 59969785) has the molecular formula C24H34N6O3 and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-cyano-2-[2-(2-ethoxyphenyl)ethyl]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine.
| Compound Name | 1-cyano-2-[2-(2-ethoxyphenyl)ethyl]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
|---|---|
| PubChem CID | 59969785 |
| Molecular Formula | C24H34N6O3 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-cyano-2-[2-(2-ethoxyphenyl)ethyl]-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
| SMILES | CCOc1ccccc1CC/N=C(\NC#N)N[C@H]1CCCCN(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C24H34N6O3/c1-2-33-21-11-4-3-9-19(21)12-13-26-24(27-18-25)28-20-10-5-6-16-30(23(20)32)17-22(31)29-14-7-8-15-29/h3-4,9,11,20H,2,5-8,10,12-17H2,1H3,(H2,26,27,28)/t20-/m0/s1 |
| InChIKey | JSZZLRBWHQJCND-FQEVSTJZSA-N |
| XLogP | 1.65 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|