C22H29BrN6O2 — CID 59969722
2-[2-(4-bromophenyl)ethyl]-1-cyano-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine (PubChem CID 59969722) has the molecular formula C22H29BrN6O2 and a molecular weight of 489.42 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)ethyl]-1-cyano-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine.
| Compound Name | 2-[2-(4-bromophenyl)ethyl]-1-cyano-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
|---|---|
| PubChem CID | 59969722 |
| Molecular Formula | C22H29BrN6O2 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-[2-(4-bromophenyl)ethyl]-1-cyano-3-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
| SMILES | N#CN/C(=N\CCc1ccc(Br)cc1)N[C@H]1CCCCN(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C22H29BrN6O2/c23-18-8-6-17(7-9-18)10-11-25-22(26-16-24)27-19-5-1-2-14-29(21(19)31)15-20(30)28-12-3-4-13-28/h6-9,19H,1-5,10-15H2,(H2,25,26,27)/t19-/m0/s1 |
| InChIKey | DLCSMZXFAQZQMI-IBGZPJMESA-N |
| XLogP | 2.01 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|