C15H33N5O3 — CID 20693448
N-[1-[ethyl-[2-(methylamino)propanoylamino]amino]-2-hydroxypentan-3-yl]-2-(methylamino)propanamide (PubChem CID 20693448) has the molecular formula C15H33N5O3 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[1-[ethyl-[2-(methylamino)propanoylamino]amino]-2-hydroxypentan-3-yl]-2-(methylamino)propanamide.
| Compound Name | N-[1-[ethyl-[2-(methylamino)propanoylamino]amino]-2-hydroxypentan-3-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 20693448 |
| Molecular Formula | C15H33N5O3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | N-[1-[ethyl-[2-(methylamino)propanoylamino]amino]-2-hydroxypentan-3-yl]-2-(methylamino)propanamide |
| SMILES | CCC(NC(=O)C(C)NC)C(O)CN(CC)NC(=O)C(C)NC |
| InChI | InChI=1S/C15H33N5O3/c1-7-12(18-14(22)10(3)16-5)13(21)9-20(8-2)19-15(23)11(4)17-6/h10-13,16-17,21H,7-9H2,1-6H3,(H,18,22)(H,19,23) |
| InChIKey | DWNSQVFPSQQHLY-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|