oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate

C16H28O3 — CID 20698004

IUPACoxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate
SMILESCC(C)C1CC(C)C(C(=O)OC2CCCO2)C(C)C1
InChIInChI=1S/C16H28O3/c1-10(2)13-8-11(3)15(12(4)9-13)16(17)19-14-6-5-7-18-14/h10-15H,5-9H2,1-4H3
InChIKeyQYXRXVHMNZVWRQ-UHFFFAOYSA-N
MW268.40 g/mol
LogP3.62
Rot. Bonds3

About oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate

oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 20698004) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate.

Molecular Properties

Compound Nameoxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate
PubChem CID20698004
Molecular FormulaC16H28O3
Molecular Weight268.40 g/mol
Exact Mass268.20
IUPAC Nameoxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate
SMILESCC(C)C1CC(C)C(C(=O)OC2CCCO2)C(C)C1
InChIInChI=1S/C16H28O3/c1-10(2)13-8-11(3)15(12(4)9-13)16(17)19-14-6-5-7-18-14/h10-15H,5-9H2,1-4H3
InChIKeyQYXRXVHMNZVWRQ-UHFFFAOYSA-N
XLogP3.62
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.40
LogP ≤ 53.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate (CID 20698004) is oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate is CC(C)C1CC(C)C(C(=O)OC2CCCO2)C(C)C1.
What is the InChIKey of oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is QYXRXVHMNZVWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-10(2)13-8-11(3)15(12(4)9-13)16(17)19-14-6-5-7-18-14/h10-15H,5-9H2,1-4H3.
What are the key properties of oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate?
oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 268.40 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-yl 2,6-dimethyl-4-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 20698004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).