C27H39NO3SSi — CID 20699501
2-trimethylsilylethyl 3-[3-(2-methylphenyl)-4-(4-methylsulfanylbutan-2-ylcarbamoyl)phenyl]propanoate (PubChem CID 20699501) has the molecular formula C27H39NO3SSi and a molecular weight of 485.77 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-[3-(2-methylphenyl)-4-(4-methylsulfanylbutan-2-ylcarbamoyl)phenyl]propanoate.
| Compound Name | 2-trimethylsilylethyl 3-[3-(2-methylphenyl)-4-(4-methylsulfanylbutan-2-ylcarbamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 20699501 |
| Molecular Formula | C27H39NO3SSi |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2-trimethylsilylethyl 3-[3-(2-methylphenyl)-4-(4-methylsulfanylbutan-2-ylcarbamoyl)phenyl]propanoate |
| SMILES | CSCCC(C)NC(=O)c1ccc(CCC(=O)OCC[Si](C)(C)C)cc1-c1ccccc1C |
| InChI | InChI=1S/C27H39NO3SSi/c1-20-9-7-8-10-23(20)25-19-22(12-14-26(29)31-16-18-33(4,5)6)11-13-24(25)27(30)28-21(2)15-17-32-3/h7-11,13,19,21H,12,14-18H2,1-6H3,(H,28,30) |
| InChIKey | MVOYBPDOIGXYJC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|