C20H24N2O — CID 20702004
N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine (PubChem CID 20702004) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine.
| Compound Name | N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine |
|---|---|
| PubChem CID | 20702004 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-cyclohexyl-1-[5-(C-methyl-N-phenylcarbonimidoyl)furan-2-yl]ethanimine |
| SMILES | C/C(=N\c1ccccc1)c1ccc(/C(C)=N/C2CCCCC2)o1 |
| InChI | InChI=1S/C20H24N2O/c1-15(21-17-9-5-3-6-10-17)19-13-14-20(23-19)16(2)22-18-11-7-4-8-12-18/h3,5-6,9-10,13-14,18H,4,7-8,11-12H2,1-2H3/b21-15+,22-16+ |
| InChIKey | KUBFCUJPJDDCME-YHARCJFQSA-N |
| XLogP | 5.56 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|