C43H50N2O9Si — CID 20707333
1-O-methyl 5-O-(3-trimethoxysilylpropyl) 4-[2-[4-[[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]oxymethyl]phenyl]propyl]-2-ethyl-2,4-dimethylpentanedioate (PubChem CID 20707333) has the molecular formula C43H50N2O9Si and a molecular weight of 766.96 g/mol. Its IUPAC name is 1-O-methyl 5-O-(3-trimethoxysilylpropyl) 4-[2-[4-[[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]oxymethyl]phenyl]propyl]-2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(3-trimethoxysilylpropyl) 4-[2-[4-[[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]oxymethyl]phenyl]propyl]-2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 20707333 |
| Molecular Formula | C43H50N2O9Si |
| Molecular Weight | 766.96 g/mol |
| Exact Mass | 766.33 |
| IUPAC Name | 1-O-methyl 5-O-(3-trimethoxysilylpropyl) 4-[2-[4-[[(9E)-9-[cyano(isocyano)methylidene]fluorene-4-carbonyl]oxymethyl]phenyl]propyl]-2-ethyl-2,4-dimethylpentanedioate |
| SMILES | [C-]#[N+]/C(C#N)=C1\c2ccccc2-c2c(C(=O)OCc3ccc(C(C)CC(C)(CC(C)(CC)C(=O)OC)C(=O)OCCC[Si](OC)(OC)OC)cc3)cccc21 |
| InChI | InChI=1S/C43H50N2O9Si/c1-10-42(3,40(47)49-6)28-43(4,41(48)53-23-14-24-55(50-7,51-8)52-9)25-29(2)31-21-19-30(20-22-31)27-54-39(46)35-18-13-17-34-37(35)32-15-11-12-16-33(32)38(34)36(26-44)45-5/h11-13,15-22,29H,10,14,23-25,27-28H2,1-4,6-9H3/b38-36+ |
| InChIKey | BUNOAJZDZCHKEP-BSKJHSHCSA-N |
| XLogP | 8.52 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.96 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|