C9H17NO3V — CID 20707842
carbanide;[4-(2,2-dihydroxyethyl)piperidin-1-yl]methanone;vanadium(2+) (PubChem CID 20707842) has the molecular formula C9H17NO3V and a molecular weight of 238.18 g/mol. Its IUPAC name is carbanide;[4-(2,2-dihydroxyethyl)piperidin-1-yl]methanone;vanadium(2+).
| Compound Name | carbanide;[4-(2,2-dihydroxyethyl)piperidin-1-yl]methanone;vanadium(2+) |
|---|---|
| PubChem CID | 20707842 |
| Molecular Formula | C9H17NO3V |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | carbanide;[4-(2,2-dihydroxyethyl)piperidin-1-yl]methanone;vanadium(2+) |
| SMILES | O=[C-]N1CCC(CC(O)O)CC1.[CH3-].[V+2] |
| InChI | InChI=1S/C8H14NO3.CH3.V/c10-6-9-3-1-7(2-4-9)5-8(11)12;;/h7-8,11-12H,1-5H2;1H3;/q2*-1;+2 |
| InChIKey | SMZQLTKMCUUUDN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|