About actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol
actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol (PubChem CID 20708357) has the molecular formula C12H14Ac2O3
and a molecular weight of 660.24 g/mol. Its IUPAC name is actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol.
Molecular Properties
| Compound Name | actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol |
| PubChem CID | 20708357 |
| Molecular Formula | C12H14Ac2O3 |
| Molecular Weight | 660.24 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol |
| SMILES | Cc1oc2c(O)cccc2c1CC(C)O.[Ac].[Ac] |
| InChI | InChI=1S/C12H14O3.2Ac/c1-7(13)6-10-8(2)15-12-9(10)4-3-5-11(12)14;;/h3-5,7,13-14H,6H2,1-2H3;; |
| InChIKey | AVHOTWKCWAAADZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 660.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol?
The IUPAC name of actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol (CID 20708357) is actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol.
What is the SMILES notation for actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol?
The canonical SMILES for actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol is Cc1oc2c(O)cccc2c1CC(C)O.[Ac].[Ac].
What is the InChIKey of actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol?
The InChIKey is AVHOTWKCWAAADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3.2Ac/c1-7(13)6-10-8(2)15-12-9(10)4-3-5-11(12)14;;/h3-5,7,13-14H,6H2,1-2H3;;.
What are the key properties of actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol?
actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol has a molecular weight of 660.24 g/mol, XLogP of 2.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;3-(2-hydroxypropyl)-2-methyl-1-benzofuran-7-ol is sourced from PubChem (CID 20708357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).